C24H44O7-2 — CID 18318706
2-[2-[2-(carboxylatomethoxy)ethoxy]ethoxy]-2-octyldecanoate (PubChem CID 18318706) has the molecular formula C24H44O7-2 and a molecular weight of 444.61 g/mol. Its IUPAC name is 2-[2-[2-(carboxylatomethoxy)ethoxy]ethoxy]-2-octyldecanoate.
| Compound Name | 2-[2-[2-(carboxylatomethoxy)ethoxy]ethoxy]-2-octyldecanoate |
|---|---|
| PubChem CID | 18318706 |
| Molecular Formula | C24H44O7-2 |
| Molecular Weight | 444.61 g/mol |
| Exact Mass | 444.31 |
| IUPAC Name | 2-[2-[2-(carboxylatomethoxy)ethoxy]ethoxy]-2-octyldecanoate |
| SMILES | CCCCCCCCC(CCCCCCCC)(OCCOCCOCC(=O)[O-])C(=O)[O-] |
| InChI | InChI=1S/C24H46O7/c1-3-5-7-9-11-13-15-24(23(27)28,16-14-12-10-8-6-4-2)31-20-19-29-17-18-30-21-22(25)26/h3-21H2,1-2H3,(H,25,26)(H,27,28)/p-2 |
| InChIKey | PNRBDYGTBXBIRQ-UHFFFAOYSA-L |
| XLogP | 2.78 |
| TPSA | 107.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.61 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|