C14H29NO4 — CID 57274402
2-[2-(2-octoxyethoxy)ethoxy]acetamide (PubChem CID 57274402) has the molecular formula C14H29NO4 and a molecular weight of 275.39 g/mol. Its IUPAC name is 2-[2-(2-octoxyethoxy)ethoxy]acetamide.
| Compound Name | 2-[2-(2-octoxyethoxy)ethoxy]acetamide |
|---|---|
| PubChem CID | 57274402 |
| Molecular Formula | C14H29NO4 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.21 |
| IUPAC Name | 2-[2-(2-octoxyethoxy)ethoxy]acetamide |
| SMILES | CCCCCCCCOCCOCCOCC(N)=O |
| InChI | InChI=1S/C14H29NO4/c1-2-3-4-5-6-7-8-17-9-10-18-11-12-19-13-14(15)16/h2-13H2,1H3,(H2,15,16) |
| InChIKey | TZYACKHWTCSHJY-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|