About 3-dodecoxypropanamide
3-dodecoxypropanamide (PubChem CID 22235134) has the molecular formula C15H31NO2
and a molecular weight of 257.42 g/mol. Its IUPAC name is 3-dodecoxypropanamide.
Molecular Properties
| Compound Name | 3-dodecoxypropanamide |
| PubChem CID | 22235134 |
| Molecular Formula | C15H31NO2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.24 |
| IUPAC Name | 3-dodecoxypropanamide |
| SMILES | CCCCCCCCCCCCOCCC(N)=O |
| InChI | InChI=1S/C15H31NO2/c1-2-3-4-5-6-7-8-9-10-11-13-18-14-12-15(16)17/h2-14H2,1H3,(H2,16,17) |
| InChIKey | VAFLFQIKLLBYJN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-dodecoxypropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-dodecoxypropanamide?
The IUPAC name of 3-dodecoxypropanamide (CID 22235134) is 3-dodecoxypropanamide.
What is the SMILES notation for 3-dodecoxypropanamide?
The canonical SMILES for 3-dodecoxypropanamide is CCCCCCCCCCCCOCCC(N)=O.
What is the InChIKey of 3-dodecoxypropanamide?
The InChIKey is VAFLFQIKLLBYJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31NO2/c1-2-3-4-5-6-7-8-9-10-11-13-18-14-12-15(16)17/h2-14H2,1H3,(H2,16,17).
What are the key properties of 3-dodecoxypropanamide?
3-dodecoxypropanamide has a molecular weight of 257.42 g/mol, XLogP of 3.80, 14 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-dodecoxypropanamide is sourced from PubChem (CID 22235134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).