About 3-butoxypropanamide;ethane
3-butoxypropanamide;ethane (PubChem CID 176554640) has the molecular formula C9H21NO2
and a molecular weight of 175.27 g/mol. Its IUPAC name is 3-butoxypropanamide;ethane.
Molecular Properties
| Compound Name | 3-butoxypropanamide;ethane |
| PubChem CID | 176554640 |
| Molecular Formula | C9H21NO2 |
| Molecular Weight | 175.27 g/mol |
| Exact Mass | 175.16 |
| IUPAC Name | 3-butoxypropanamide;ethane |
| SMILES | CC.CCCCOCCC(N)=O |
| InChI | InChI=1S/C7H15NO2.C2H6/c1-2-3-5-10-6-4-7(8)9;1-2/h2-6H2,1H3,(H2,8,9);1-2H3 |
| InChIKey | RCVXZNXGKDIGGL-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.27 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-butoxypropanamide;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butoxypropanamide;ethane?
The IUPAC name of 3-butoxypropanamide;ethane (CID 176554640) is 3-butoxypropanamide;ethane.
What is the SMILES notation for 3-butoxypropanamide;ethane?
The canonical SMILES for 3-butoxypropanamide;ethane is CC.CCCCOCCC(N)=O.
What is the InChIKey of 3-butoxypropanamide;ethane?
The InChIKey is RCVXZNXGKDIGGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.C2H6/c1-2-3-5-10-6-4-7(8)9;1-2/h2-6H2,1H3,(H2,8,9);1-2H3.
What are the key properties of 3-butoxypropanamide;ethane?
3-butoxypropanamide;ethane has a molecular weight of 175.27 g/mol, XLogP of 1.70, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butoxypropanamide;ethane is sourced from PubChem (CID 176554640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).