C8H17NO5 — CID 87940620
2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]acetamide (PubChem CID 87940620) has the molecular formula C8H17NO5 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]acetamide.
| Compound Name | 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 87940620 |
| Molecular Formula | C8H17NO5 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.11 |
| IUPAC Name | 2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]acetamide |
| SMILES | NC(=O)COCCOCCOCCO |
| InChI | InChI=1S/C8H17NO5/c9-8(11)7-14-6-5-13-4-3-12-2-1-10/h10H,1-7H2,(H2,9,11) |
| InChIKey | OOWORAQZXONIRK-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 91.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|