C6H15N3O3 — CID 123413138
2-[2-(2-hydrazinylethoxy)ethoxy]acetamide (PubChem CID 123413138) has the molecular formula C6H15N3O3 and a molecular weight of 177.20 g/mol. Its IUPAC name is 2-[2-(2-hydrazinylethoxy)ethoxy]acetamide.
| Compound Name | 2-[2-(2-hydrazinylethoxy)ethoxy]acetamide |
|---|---|
| PubChem CID | 123413138 |
| Molecular Formula | C6H15N3O3 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.11 |
| IUPAC Name | 2-[2-(2-hydrazinylethoxy)ethoxy]acetamide |
| SMILES | NNCCOCCOCC(N)=O |
| InChI | InChI=1S/C6H15N3O3/c7-6(10)5-12-4-3-11-2-1-9-8/h9H,1-5,8H2,(H2,7,10) |
| InChIKey | OLVZZKMVUIWMRT-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|