C27H54N6O12 — CID 123291674
2-[3-[2-[[2-[3-[2-[[2-[3-[2-[[2-[2-(2-hydrazinylethoxy)ethoxy]acetyl]amino]ethoxy]propoxy]acetyl]amino]ethoxy]propoxy]acetyl]amino]ethoxy]propoxy]acetamide (PubChem CID 123291674) has the molecular formula C27H54N6O12 and a molecular weight of 654.76 g/mol. Its IUPAC name is 2-[3-[2-[[2-[3-[2-[[2-[3-[2-[[2-[2-(2-hydrazinylethoxy)ethoxy]acetyl]amino]ethoxy]propoxy]acetyl]amino]ethoxy]propoxy]acetyl]amino]ethoxy]propoxy]acetamide.
| Compound Name | 2-[3-[2-[[2-[3-[2-[[2-[3-[2-[[2-[2-(2-hydrazinylethoxy)ethoxy]acetyl]amino]ethoxy]propoxy]acetyl]amino]ethoxy]propoxy]acetyl]amino]ethoxy]propoxy]acetamide |
|---|---|
| PubChem CID | 123291674 |
| Molecular Formula | C27H54N6O12 |
| Molecular Weight | 654.76 g/mol |
| Exact Mass | 654.38 |
| IUPAC Name | 2-[3-[2-[[2-[3-[2-[[2-[3-[2-[[2-[2-(2-hydrazinylethoxy)ethoxy]acetyl]amino]ethoxy]propoxy]acetyl]amino]ethoxy]propoxy]acetyl]amino]ethoxy]propoxy]acetamide |
| SMILES | NNCCOCCOCC(=O)NCCOCCCOCC(=O)NCCOCCCOCC(=O)NCCOCCCOCC(N)=O |
| InChI | InChI=1S/C27H54N6O12/c28-24(34)20-42-11-1-8-38-14-4-30-25(35)21-43-12-2-9-39-15-5-31-26(36)22-44-13-3-10-40-16-6-32-27(37)23-45-19-18-41-17-7-33-29/h33H,1-23,29H2,(H2,28,34)(H,30,35)(H,31,36)(H,32,37) |
| InChIKey | HVVSGPVOUQCVFX-UHFFFAOYSA-N |
| XLogP | -3.41 |
| TPSA | 242.28 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 35 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.76 |
| LogP ≤ 5 | -3.41 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|