C19H38N4O8 — CID 123976668
2-[[2-[2-[2-[[2-[2-(2-hydrazinylethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]heptanoic acid (PubChem CID 123976668) has the molecular formula C19H38N4O8 and a molecular weight of 450.53 g/mol. Its IUPAC name is 2-[[2-[2-[2-[[2-[2-(2-hydrazinylethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]heptanoic acid.
| Compound Name | 2-[[2-[2-[2-[[2-[2-(2-hydrazinylethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]heptanoic acid |
|---|---|
| PubChem CID | 123976668 |
| Molecular Formula | C19H38N4O8 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.27 |
| IUPAC Name | 2-[[2-[2-[2-[[2-[2-(2-hydrazinylethoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetyl]amino]heptanoic acid |
| SMILES | CCCCCC(NC(=O)COCCOCCNC(=O)COCCOCCNN)C(=O)O |
| InChI | InChI=1S/C19H38N4O8/c1-2-3-4-5-16(19(26)27)23-18(25)15-31-13-10-28-8-6-21-17(24)14-30-12-11-29-9-7-22-20/h16,22H,2-15,20H2,1H3,(H,21,24)(H,23,25)(H,26,27) |
| InChIKey | MSQYZSAYYIFCFH-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 170.47 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|