C19H34BrN3O8 — CID 90261192
(2S)-6-[(2-bromoacetyl)amino]-2-[[2-[2-[2-[(2-propoxyacetyl)amino]ethoxy]ethoxy]acetyl]amino]hexanoic acid (PubChem CID 90261192) has the molecular formula C19H34BrN3O8 and a molecular weight of 512.40 g/mol. Its IUPAC name is (2S)-6-[(2-bromoacetyl)amino]-2-[[2-[2-[2-[(2-propoxyacetyl)amino]ethoxy]ethoxy]acetyl]amino]hexanoic acid.
| Compound Name | (2S)-6-[(2-bromoacetyl)amino]-2-[[2-[2-[2-[(2-propoxyacetyl)amino]ethoxy]ethoxy]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 90261192 |
| Molecular Formula | C19H34BrN3O8 |
| Molecular Weight | 512.40 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | (2S)-6-[(2-bromoacetyl)amino]-2-[[2-[2-[2-[(2-propoxyacetyl)amino]ethoxy]ethoxy]acetyl]amino]hexanoic acid |
| SMILES | CCCOCC(=O)NCCOCCOCC(=O)N[C@@H](CCCCNC(=O)CBr)C(=O)O |
| InChI | InChI=1S/C19H34BrN3O8/c1-2-8-30-13-17(25)22-7-9-29-10-11-31-14-18(26)23-15(19(27)28)5-3-4-6-21-16(24)12-20/h15H,2-14H2,1H3,(H,21,24)(H,22,25)(H,23,26)(H,27,28)/t15-/m0/s1 |
| InChIKey | HEFAHOOFAKWVJE-HNNXBMFYSA-N |
| XLogP | -0.19 |
| TPSA | 152.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.40 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|