C22H40N2O9 — CID 159013278
5-oxo-8-[2-[2-oxo-2-[2-(2-propoxyethoxy)ethylamino]ethoxy]ethoxy]-2-(propanoylamino)octanoic acid (PubChem CID 159013278) has the molecular formula C22H40N2O9 and a molecular weight of 476.57 g/mol. Its IUPAC name is 5-oxo-8-[2-[2-oxo-2-[2-(2-propoxyethoxy)ethylamino]ethoxy]ethoxy]-2-(propanoylamino)octanoic acid.
| Compound Name | 5-oxo-8-[2-[2-oxo-2-[2-(2-propoxyethoxy)ethylamino]ethoxy]ethoxy]-2-(propanoylamino)octanoic acid |
|---|---|
| PubChem CID | 159013278 |
| Molecular Formula | C22H40N2O9 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.27 |
| IUPAC Name | 5-oxo-8-[2-[2-oxo-2-[2-(2-propoxyethoxy)ethylamino]ethoxy]ethoxy]-2-(propanoylamino)octanoic acid |
| SMILES | CCCOCCOCCNC(=O)COCCOCCCC(=O)CCC(NC(=O)CC)C(=O)O |
| InChI | InChI=1S/C22H40N2O9/c1-3-10-30-13-14-32-12-9-23-21(27)17-33-16-15-31-11-5-6-18(25)7-8-19(22(28)29)24-20(26)4-2/h19H,3-17H2,1-2H3,(H,23,27)(H,24,26)(H,28,29) |
| InChIKey | ANXCREWVRYNUNV-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|