C20H36N2O9 — CID 158031522
2-(methylamino)-5-oxo-8-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]octanoic acid (PubChem CID 158031522) has the molecular formula C20H36N2O9 and a molecular weight of 448.51 g/mol. Its IUPAC name is 2-(methylamino)-5-oxo-8-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]octanoic acid.
| Compound Name | 2-(methylamino)-5-oxo-8-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]octanoic acid |
|---|---|
| PubChem CID | 158031522 |
| Molecular Formula | C20H36N2O9 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | 2-(methylamino)-5-oxo-8-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]octanoic acid |
| SMILES | CNC(CCC(=O)CCCOCCOCC(=O)NCCOCCOCC(C)=O)C(=O)O |
| InChI | InChI=1S/C20H36N2O9/c1-16(23)14-30-12-11-29-9-7-22-19(25)15-31-13-10-28-8-3-4-17(24)5-6-18(21-2)20(26)27/h18,21H,3-15H2,1-2H3,(H,22,25)(H,26,27) |
| InChIKey | QNBUTIJQTWKJSR-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 149.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|