C20H38N2O10S — CID 158834568
2-(methylamino)-5-oxo-8-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]octane-1-sulfonic acid (PubChem CID 158834568) has the molecular formula C20H38N2O10S and a molecular weight of 498.60 g/mol. Its IUPAC name is 2-(methylamino)-5-oxo-8-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]octane-1-sulfonic acid.
| Compound Name | 2-(methylamino)-5-oxo-8-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]octane-1-sulfonic acid |
|---|---|
| PubChem CID | 158834568 |
| Molecular Formula | C20H38N2O10S |
| Molecular Weight | 498.60 g/mol |
| Exact Mass | 498.22 |
| IUPAC Name | 2-(methylamino)-5-oxo-8-[2-[2-oxo-2-[2-[2-(2-oxopropoxy)ethoxy]ethylamino]ethoxy]ethoxy]octane-1-sulfonic acid |
| SMILES | CNC(CCC(=O)CCCOCCOCC(=O)NCCOCCOCC(C)=O)CS(=O)(=O)O |
| InChI | InChI=1S/C20H38N2O10S/c1-17(23)14-31-12-11-30-9-7-22-20(25)15-32-13-10-29-8-3-4-19(24)6-5-18(21-2)16-33(26,27)28/h18,21H,3-16H2,1-2H3,(H,22,25)(H,26,27,28) |
| InChIKey | AKDAXSHSWJHDLZ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 166.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.60 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|