C27H50N2O8 — CID 157081898
N-[(5S)-5-methyl-6-oxoheptyl]-2-[2-[2-[[2-[2-(4-oxononoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetamide (PubChem CID 157081898) has the molecular formula C27H50N2O8 and a molecular weight of 530.70 g/mol. Its IUPAC name is N-[(5S)-5-methyl-6-oxoheptyl]-2-[2-[2-[[2-[2-(4-oxononoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetamide.
| Compound Name | N-[(5S)-5-methyl-6-oxoheptyl]-2-[2-[2-[[2-[2-(4-oxononoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 157081898 |
| Molecular Formula | C27H50N2O8 |
| Molecular Weight | 530.70 g/mol |
| Exact Mass | 530.36 |
| IUPAC Name | N-[(5S)-5-methyl-6-oxoheptyl]-2-[2-[2-[[2-[2-(4-oxononoxy)ethoxy]acetyl]amino]ethoxy]ethoxy]acetamide |
| SMILES | CCCCCC(=O)CCCOCCOCC(=O)NCCOCCOCC(=O)NCCCC[C@H](C)C(C)=O |
| InChI | InChI=1S/C27H50N2O8/c1-4-5-6-11-25(31)12-9-15-34-17-19-36-22-27(33)29-14-16-35-18-20-37-21-26(32)28-13-8-7-10-23(2)24(3)30/h23H,4-22H2,1-3H3,(H,28,32)(H,29,33)/t23-/m0/s1 |
| InChIKey | QMPKSTIDLNSREH-QHCPKHFHSA-N |
| XLogP | 2.61 |
| TPSA | 129.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.70 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|