C20H37NO6 — CID 158573658
N-[(5S)-5-methyl-6-oxoheptyl]-2-[2-(4-oxo-5-propoxypentoxy)ethoxy]acetamide (PubChem CID 158573658) has the molecular formula C20H37NO6 and a molecular weight of 387.52 g/mol. Its IUPAC name is N-[(5S)-5-methyl-6-oxoheptyl]-2-[2-(4-oxo-5-propoxypentoxy)ethoxy]acetamide.
| Compound Name | N-[(5S)-5-methyl-6-oxoheptyl]-2-[2-(4-oxo-5-propoxypentoxy)ethoxy]acetamide |
|---|---|
| PubChem CID | 158573658 |
| Molecular Formula | C20H37NO6 |
| Molecular Weight | 387.52 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | N-[(5S)-5-methyl-6-oxoheptyl]-2-[2-(4-oxo-5-propoxypentoxy)ethoxy]acetamide |
| SMILES | CCCOCC(=O)CCCOCCOCC(=O)NCCCC[C@H](C)C(C)=O |
| InChI | InChI=1S/C20H37NO6/c1-4-11-26-15-19(23)9-7-12-25-13-14-27-16-20(24)21-10-6-5-8-17(2)18(3)22/h17H,4-16H2,1-3H3,(H,21,24)/t17-/m0/s1 |
| InChIKey | FCBMGJYIOLTXJY-KRWDZBQOSA-N |
| XLogP | 2.31 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.52 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|