C18H33NO7 — CID 58214492
2-[2-(4-oxoheptoxy)ethoxy]-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]acetamide (PubChem CID 58214492) has the molecular formula C18H33NO7 and a molecular weight of 375.46 g/mol. Its IUPAC name is 2-[2-(4-oxoheptoxy)ethoxy]-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]acetamide.
| Compound Name | 2-[2-(4-oxoheptoxy)ethoxy]-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]acetamide |
|---|---|
| PubChem CID | 58214492 |
| Molecular Formula | C18H33NO7 |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 375.23 |
| IUPAC Name | 2-[2-(4-oxoheptoxy)ethoxy]-N-[2-[2-(2-oxopropoxy)ethoxy]ethyl]acetamide |
| SMILES | CCCC(=O)CCCOCCOCC(=O)NCCOCCOCC(C)=O |
| InChI | InChI=1S/C18H33NO7/c1-3-5-17(21)6-4-8-23-10-13-26-15-18(22)19-7-9-24-11-12-25-14-16(2)20/h3-15H2,1-2H3,(H,19,22) |
| InChIKey | SJRREKAKEPHNCX-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|