C22H39NO8 — CID 58143549
6-oxo-N-[2-[2-[2-oxo-5-[2-(2-oxopropoxy)ethoxy]pentoxy]ethoxy]ethyl]octanamide (PubChem CID 58143549) has the molecular formula C22H39NO8 and a molecular weight of 445.55 g/mol. Its IUPAC name is 6-oxo-N-[2-[2-[2-oxo-5-[2-(2-oxopropoxy)ethoxy]pentoxy]ethoxy]ethyl]octanamide.
| Compound Name | 6-oxo-N-[2-[2-[2-oxo-5-[2-(2-oxopropoxy)ethoxy]pentoxy]ethoxy]ethyl]octanamide |
|---|---|
| PubChem CID | 58143549 |
| Molecular Formula | C22H39NO8 |
| Molecular Weight | 445.55 g/mol |
| Exact Mass | 445.27 |
| IUPAC Name | 6-oxo-N-[2-[2-[2-oxo-5-[2-(2-oxopropoxy)ethoxy]pentoxy]ethoxy]ethyl]octanamide |
| SMILES | CCC(=O)CCCCC(=O)NCCOCCOCC(=O)CCCOCCOCC(C)=O |
| InChI | InChI=1S/C22H39NO8/c1-3-20(25)7-4-5-9-22(27)23-10-12-29-14-16-31-18-21(26)8-6-11-28-13-15-30-17-19(2)24/h3-18H2,1-2H3,(H,23,27) |
| InChIKey | FPJWDDYXBUNIIS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 117.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.55 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|