C25H49NO9 — CID 155405230
9-methoxy-N-[2-[2-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]nonanamide (PubChem CID 155405230) has the molecular formula C25H49NO9 and a molecular weight of 507.67 g/mol. Its IUPAC name is 9-methoxy-N-[2-[2-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]nonanamide.
| Compound Name | 9-methoxy-N-[2-[2-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]nonanamide |
|---|---|
| PubChem CID | 155405230 |
| Molecular Formula | C25H49NO9 |
| Molecular Weight | 507.67 g/mol |
| Exact Mass | 507.34 |
| IUPAC Name | 9-methoxy-N-[2-[2-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl]nonanamide |
| SMILES | COCCCCCCCCC(=O)NCCOCCOCCOCCOCCOCCOCC(C)=O |
| InChI | InChI=1S/C25H49NO9/c1-24(27)23-35-22-21-34-20-19-33-18-17-32-16-15-31-14-13-30-12-10-26-25(28)9-7-5-3-4-6-8-11-29-2/h3-23H2,1-2H3,(H,26,28) |
| InChIKey | SFSYVGXEEQEOTR-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 110.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.67 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|