C20H39NO7V — CID 155741032
9-hydroxy-N-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]nonanamide;vanadium (PubChem CID 155741032) has the molecular formula C20H39NO7V and a molecular weight of 456.48 g/mol. Its IUPAC name is 9-hydroxy-N-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]nonanamide;vanadium.
| Compound Name | 9-hydroxy-N-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]nonanamide;vanadium |
|---|---|
| PubChem CID | 155741032 |
| Molecular Formula | C20H39NO7V |
| Molecular Weight | 456.48 g/mol |
| Exact Mass | 456.22 |
| IUPAC Name | 9-hydroxy-N-[2-[2-[2-[2-(2-oxopropoxy)ethoxy]ethoxy]ethoxy]ethyl]nonanamide;vanadium |
| SMILES | CC(=O)COCCOCCOCCOCCNC(=O)CCCCCCCCO.[V] |
| InChI | InChI=1S/C20H39NO7.V/c1-19(23)18-28-17-16-27-15-14-26-13-12-25-11-9-21-20(24)8-6-4-2-3-5-7-10-22;/h22H,2-18H2,1H3,(H,21,24); |
| InChIKey | GXWGRSAMCWIMEE-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 103.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.48 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|