C15H32N2O4 — CID 155740106
N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-9-hydroxynonanamide (PubChem CID 155740106) has the molecular formula C15H32N2O4 and a molecular weight of 304.43 g/mol. Its IUPAC name is N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-9-hydroxynonanamide.
| Compound Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-9-hydroxynonanamide |
|---|---|
| PubChem CID | 155740106 |
| Molecular Formula | C15H32N2O4 |
| Molecular Weight | 304.43 g/mol |
| Exact Mass | 304.24 |
| IUPAC Name | N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-9-hydroxynonanamide |
| SMILES | NCCOCCOCCNC(=O)CCCCCCCCO |
| InChI | InChI=1S/C15H32N2O4/c16-8-11-20-13-14-21-12-9-17-15(19)7-5-3-1-2-4-6-10-18/h18H,1-14,16H2,(H,17,19) |
| InChIKey | ROMKCYXAOWZGIG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 93.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.43 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|