C14H30N2O5 — CID 118439735
3-[2-[2-(aminomethoxy)ethoxy]ethoxy]-N-(6-hydroxyhexyl)propanamide (PubChem CID 118439735) has the molecular formula C14H30N2O5 and a molecular weight of 306.40 g/mol. Its IUPAC name is 3-[2-[2-(aminomethoxy)ethoxy]ethoxy]-N-(6-hydroxyhexyl)propanamide.
| Compound Name | 3-[2-[2-(aminomethoxy)ethoxy]ethoxy]-N-(6-hydroxyhexyl)propanamide |
|---|---|
| PubChem CID | 118439735 |
| Molecular Formula | C14H30N2O5 |
| Molecular Weight | 306.40 g/mol |
| Exact Mass | 306.22 |
| IUPAC Name | 3-[2-[2-(aminomethoxy)ethoxy]ethoxy]-N-(6-hydroxyhexyl)propanamide |
| SMILES | NCOCCOCCOCCC(=O)NCCCCCCO |
| InChI | InChI=1S/C14H30N2O5/c15-13-21-12-11-20-10-9-19-8-5-14(18)16-6-3-1-2-4-7-17/h17H,1-13,15H2,(H,16,18) |
| InChIKey | WTNBXGGKLBQBTI-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 103.04 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.40 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|