About N-(4-aminooxybutyl)-N'-(3-hydroxypropyl)pentanediamide
N-(4-aminooxybutyl)-N'-(3-hydroxypropyl)pentanediamide (PubChem CID 89252423) has the molecular formula C12H25N3O4
and a molecular weight of 275.35 g/mol. Its IUPAC name is N-(4-aminooxybutyl)-N'-(3-hydroxypropyl)pentanediamide.
Molecular Properties
| Compound Name | N-(4-aminooxybutyl)-N'-(3-hydroxypropyl)pentanediamide |
| PubChem CID | 89252423 |
| Molecular Formula | C12H25N3O4 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.18 |
| IUPAC Name | N-(4-aminooxybutyl)-N'-(3-hydroxypropyl)pentanediamide |
| SMILES | NOCCCCNC(=O)CCCC(=O)NCCCO |
| InChI | InChI=1S/C12H25N3O4/c13-19-10-2-1-7-14-11(17)5-3-6-12(18)15-8-4-9-16/h16H,1-10,13H2,(H,14,17)(H,15,18) |
| InChIKey | CGWVMPLTGGDPOG-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 113.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(4-aminooxybutyl)-N'-(3-hydroxypropyl)pentanediamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-aminooxybutyl)-N'-(3-hydroxypropyl)pentanediamide?
The IUPAC name of N-(4-aminooxybutyl)-N'-(3-hydroxypropyl)pentanediamide (CID 89252423) is N-(4-aminooxybutyl)-N'-(3-hydroxypropyl)pentanediamide.
What is the SMILES notation for N-(4-aminooxybutyl)-N'-(3-hydroxypropyl)pentanediamide?
The canonical SMILES for N-(4-aminooxybutyl)-N'-(3-hydroxypropyl)pentanediamide is NOCCCCNC(=O)CCCC(=O)NCCCO.
What is the InChIKey of N-(4-aminooxybutyl)-N'-(3-hydroxypropyl)pentanediamide?
The InChIKey is CGWVMPLTGGDPOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25N3O4/c13-19-10-2-1-7-14-11(17)5-3-6-12(18)15-8-4-9-16/h16H,1-10,13H2,(H,14,17)(H,15,18).
What are the key properties of N-(4-aminooxybutyl)-N'-(3-hydroxypropyl)pentanediamide?
N-(4-aminooxybutyl)-N'-(3-hydroxypropyl)pentanediamide has a molecular weight of 275.35 g/mol, XLogP of -0.56, 12 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-aminooxybutyl)-N'-(3-hydroxypropyl)pentanediamide is sourced from PubChem (CID 89252423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).