C15H32N2O5 — CID 140926568
N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]-3-ethoxypropanamide (PubChem CID 140926568) has the molecular formula C15H32N2O5 and a molecular weight of 320.43 g/mol. Its IUPAC name is N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]-3-ethoxypropanamide.
| Compound Name | N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]-3-ethoxypropanamide |
|---|---|
| PubChem CID | 140926568 |
| Molecular Formula | C15H32N2O5 |
| Molecular Weight | 320.43 g/mol |
| Exact Mass | 320.23 |
| IUPAC Name | N-[3-[2-[2-(3-aminopropoxy)ethoxy]ethoxy]propyl]-3-ethoxypropanamide |
| SMILES | CCOCCC(=O)NCCCOCCOCCOCCCN |
| InChI | InChI=1S/C15H32N2O5/c1-2-19-10-5-15(18)17-7-4-9-21-12-14-22-13-11-20-8-3-6-16/h2-14,16H2,1H3,(H,17,18) |
| InChIKey | QZKLCIKJKTZQJQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 92.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.43 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|