C23H44ClN3O7 — CID 126550925
N'-[3-[2-[2-[3-(3-chloropropanoylamino)propoxy]ethoxy]ethoxy]propyl]-N-(3-ethoxypropyl)pentanediamide (PubChem CID 126550925) has the molecular formula C23H44ClN3O7 and a molecular weight of 510.07 g/mol. Its IUPAC name is N'-[3-[2-[2-[3-(3-chloropropanoylamino)propoxy]ethoxy]ethoxy]propyl]-N-(3-ethoxypropyl)pentanediamide.
| Compound Name | N'-[3-[2-[2-[3-(3-chloropropanoylamino)propoxy]ethoxy]ethoxy]propyl]-N-(3-ethoxypropyl)pentanediamide |
|---|---|
| PubChem CID | 126550925 |
| Molecular Formula | C23H44ClN3O7 |
| Molecular Weight | 510.07 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | N'-[3-[2-[2-[3-(3-chloropropanoylamino)propoxy]ethoxy]ethoxy]propyl]-N-(3-ethoxypropyl)pentanediamide |
| SMILES | CCOCCCNC(=O)CCCC(=O)NCCCOCCOCCOCCCNC(=O)CCCl |
| InChI | InChI=1S/C23H44ClN3O7/c1-2-31-14-4-11-25-21(28)7-3-8-22(29)26-12-5-15-32-17-19-34-20-18-33-16-6-13-27-23(30)9-10-24/h2-20H2,1H3,(H,25,28)(H,26,29)(H,27,30) |
| InChIKey | OJXIPWVLJNODQV-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.07 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|