C12H22BNO4 — CID 169190202
CID 169190202 (PubChem CID 169190202) has the molecular formula C12H22BNO4 and a molecular weight of 255.12 g/mol.
| Compound Name | CID 169190202 |
|---|---|
| PubChem CID | 169190202 |
| Molecular Formula | C12H22BNO4 |
| Molecular Weight | 255.12 g/mol |
| Exact Mass | 255.16 |
| IUPAC Name | — |
| SMILES | [B]C(=O)CCCCC(=O)NCCOCCOCC |
| InChI | InChI=1S/C12H22BNO4/c1-2-17-9-10-18-8-7-14-12(16)6-4-3-5-11(13)15/h2-10H2,1H3,(H,14,16) |
| InChIKey | FGGGGAKLJRZEDK-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.12 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|