C14H31NO3 — CID 177338046
5-ethoxy-N-[2-(3-methylbutoxy)ethyl]pentanamide;molecular hydrogen (PubChem CID 177338046) has the molecular formula C14H31NO3 and a molecular weight of 261.41 g/mol. Its IUPAC name is 5-ethoxy-N-[2-(3-methylbutoxy)ethyl]pentanamide;molecular hydrogen.
| Compound Name | 5-ethoxy-N-[2-(3-methylbutoxy)ethyl]pentanamide;molecular hydrogen |
|---|---|
| PubChem CID | 177338046 |
| Molecular Formula | C14H31NO3 |
| Molecular Weight | 261.41 g/mol |
| Exact Mass | 261.23 |
| IUPAC Name | 5-ethoxy-N-[2-(3-methylbutoxy)ethyl]pentanamide;molecular hydrogen |
| SMILES | CCOCCCCC(=O)NCCOCCC(C)C.[H][H] |
| InChI | InChI=1S/C14H29NO3.H2/c1-4-17-10-6-5-7-14(16)15-9-12-18-11-8-13(2)3;/h13H,4-12H2,1-3H3,(H,15,16);1H |
| InChIKey | LOSCTDKNEDGCMN-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.41 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|