C12H25NO3S — CID 156820137
4-(3-methylbutoxy)-N-(2-methylsulfanyloxyethyl)butanamide (PubChem CID 156820137) has the molecular formula C12H25NO3S and a molecular weight of 263.40 g/mol. Its IUPAC name is 4-(3-methylbutoxy)-N-(2-methylsulfanyloxyethyl)butanamide.
| Compound Name | 4-(3-methylbutoxy)-N-(2-methylsulfanyloxyethyl)butanamide |
|---|---|
| PubChem CID | 156820137 |
| Molecular Formula | C12H25NO3S |
| Molecular Weight | 263.40 g/mol |
| Exact Mass | 263.16 |
| IUPAC Name | 4-(3-methylbutoxy)-N-(2-methylsulfanyloxyethyl)butanamide |
| SMILES | CSOCCNC(=O)CCCOCCC(C)C |
| InChI | InChI=1S/C12H25NO3S/c1-11(2)6-9-15-8-4-5-12(14)13-7-10-16-17-3/h11H,4-10H2,1-3H3,(H,13,14) |
| InChIKey | YSAMINSXZQCBLR-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.40 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|