C19H41NO5 — CID 155739554
N-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethyl]-4-propan-2-yloxybutanamide;molecular hydrogen (PubChem CID 155739554) has the molecular formula C19H41NO5 and a molecular weight of 363.54 g/mol. Its IUPAC name is N-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethyl]-4-propan-2-yloxybutanamide;molecular hydrogen.
| Compound Name | N-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethyl]-4-propan-2-yloxybutanamide;molecular hydrogen |
|---|---|
| PubChem CID | 155739554 |
| Molecular Formula | C19H41NO5 |
| Molecular Weight | 363.54 g/mol |
| Exact Mass | 363.30 |
| IUPAC Name | N-[2-[2-[2-(4-methylpentoxy)ethoxy]ethoxy]ethyl]-4-propan-2-yloxybutanamide;molecular hydrogen |
| SMILES | CC(C)CCCOCCOCCOCCNC(=O)CCCOC(C)C.[H][H] |
| InChI | InChI=1S/C19H39NO5.H2/c1-17(2)7-5-10-22-13-15-24-16-14-23-12-9-20-19(21)8-6-11-25-18(3)4;/h17-18H,5-16H2,1-4H3,(H,20,21);1H |
| InChIKey | FVBNTFDJCHINMO-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.54 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|