C15H31NO3 — CID 134351969
N-(3-methylbutyl)-3-(4-propan-2-yloxybutoxy)propanamide (PubChem CID 134351969) has the molecular formula C15H31NO3 and a molecular weight of 273.42 g/mol. Its IUPAC name is N-(3-methylbutyl)-3-(4-propan-2-yloxybutoxy)propanamide.
| Compound Name | N-(3-methylbutyl)-3-(4-propan-2-yloxybutoxy)propanamide |
|---|---|
| PubChem CID | 134351969 |
| Molecular Formula | C15H31NO3 |
| Molecular Weight | 273.42 g/mol |
| Exact Mass | 273.23 |
| IUPAC Name | N-(3-methylbutyl)-3-(4-propan-2-yloxybutoxy)propanamide |
| SMILES | CC(C)CCNC(=O)CCOCCCCOC(C)C |
| InChI | InChI=1S/C15H31NO3/c1-13(2)7-9-16-15(17)8-12-18-10-5-6-11-19-14(3)4/h13-14H,5-12H2,1-4H3,(H,16,17) |
| InChIKey | IXIQZFPDTFNKBT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.42 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|