C16H35NO5 — CID 155739531
molecular hydrogen;4-propan-2-yloxy-N-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethyl]butanamide (PubChem CID 155739531) has the molecular formula C16H35NO5 and a molecular weight of 321.46 g/mol. Its IUPAC name is molecular hydrogen;4-propan-2-yloxy-N-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethyl]butanamide.
| Compound Name | molecular hydrogen;4-propan-2-yloxy-N-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethyl]butanamide |
|---|---|
| PubChem CID | 155739531 |
| Molecular Formula | C16H35NO5 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.25 |
| IUPAC Name | molecular hydrogen;4-propan-2-yloxy-N-[2-[2-(2-propan-2-yloxyethoxy)ethoxy]ethyl]butanamide |
| SMILES | CC(C)OCCCC(=O)NCCOCCOCCOC(C)C.[H][H] |
| InChI | InChI=1S/C16H33NO5.H2/c1-14(2)21-8-5-6-16(18)17-7-9-19-10-11-20-12-13-22-15(3)4;/h14-15H,5-13H2,1-4H3,(H,17,18);1H |
| InChIKey | MAQMGICDNMMKLY-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|