C22H49NO6 — CID 155740333
ethane;N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-9-propan-2-yloxynonanamide;molecular hydrogen (PubChem CID 155740333) has the molecular formula C22H49NO6 and a molecular weight of 423.64 g/mol. Its IUPAC name is ethane;N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-9-propan-2-yloxynonanamide;molecular hydrogen.
| Compound Name | ethane;N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-9-propan-2-yloxynonanamide;molecular hydrogen |
|---|---|
| PubChem CID | 155740333 |
| Molecular Formula | C22H49NO6 |
| Molecular Weight | 423.64 g/mol |
| Exact Mass | 423.36 |
| IUPAC Name | ethane;N-[2-[2-[2-(2-hydroxyethoxy)ethoxy]ethoxy]ethyl]-9-propan-2-yloxynonanamide;molecular hydrogen |
| SMILES | CC.CC(C)OCCCCCCCCC(=O)NCCOCCOCCOCCO.[H][H] |
| InChI | InChI=1S/C20H41NO6.C2H6.H2/c1-19(2)27-12-8-6-4-3-5-7-9-20(23)21-10-13-24-15-17-26-18-16-25-14-11-22;1-2;/h19,22H,3-18H2,1-2H3,(H,21,23);1-2H3;1H |
| InChIKey | UDMSEDRQPUFCGK-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 86.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.64 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|