C16H35NO3 — CID 177338040
N-[2-(3-methylpentoxy)ethyl]-5-propan-2-yloxypentanamide;molecular hydrogen (PubChem CID 177338040) has the molecular formula C16H35NO3 and a molecular weight of 289.46 g/mol. Its IUPAC name is N-[2-(3-methylpentoxy)ethyl]-5-propan-2-yloxypentanamide;molecular hydrogen.
| Compound Name | N-[2-(3-methylpentoxy)ethyl]-5-propan-2-yloxypentanamide;molecular hydrogen |
|---|---|
| PubChem CID | 177338040 |
| Molecular Formula | C16H35NO3 |
| Molecular Weight | 289.46 g/mol |
| Exact Mass | 289.26 |
| IUPAC Name | N-[2-(3-methylpentoxy)ethyl]-5-propan-2-yloxypentanamide;molecular hydrogen |
| SMILES | CCC(C)CCOCCNC(=O)CCCCOC(C)C.[H][H] |
| InChI | InChI=1S/C16H33NO3.H2/c1-5-15(4)9-12-19-13-10-17-16(18)8-6-7-11-20-14(2)3;/h14-15H,5-13H2,1-4H3,(H,17,18);1H |
| InChIKey | UYMNYJSAPIMRHE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.46 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|