C14H31NO5 — CID 156820526
3-[2-(2-ethoxyethoxy)ethoxy]-N-(2-propan-2-yloxyethyl)propanamide;molecular hydrogen (PubChem CID 156820526) has the molecular formula C14H31NO5 and a molecular weight of 293.40 g/mol. Its IUPAC name is 3-[2-(2-ethoxyethoxy)ethoxy]-N-(2-propan-2-yloxyethyl)propanamide;molecular hydrogen.
| Compound Name | 3-[2-(2-ethoxyethoxy)ethoxy]-N-(2-propan-2-yloxyethyl)propanamide;molecular hydrogen |
|---|---|
| PubChem CID | 156820526 |
| Molecular Formula | C14H31NO5 |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 3-[2-(2-ethoxyethoxy)ethoxy]-N-(2-propan-2-yloxyethyl)propanamide;molecular hydrogen |
| SMILES | CCOCCOCCOCCC(=O)NCCOC(C)C.[H][H] |
| InChI | InChI=1S/C14H29NO5.H2/c1-4-17-9-10-19-12-11-18-7-5-14(16)15-6-8-20-13(2)3;/h13H,4-12H2,1-3H3,(H,15,16);1H |
| InChIKey | MKDNNCDVWMILNW-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|