C16H39NO3 — CID 142390095
ethane;3-(4-ethoxybutoxy)-N-propylpropanamide;molecular hydrogen (PubChem CID 142390095) has the molecular formula C16H39NO3 and a molecular weight of 293.49 g/mol. Its IUPAC name is ethane;3-(4-ethoxybutoxy)-N-propylpropanamide;molecular hydrogen.
| Compound Name | ethane;3-(4-ethoxybutoxy)-N-propylpropanamide;molecular hydrogen |
|---|---|
| PubChem CID | 142390095 |
| Molecular Formula | C16H39NO3 |
| Molecular Weight | 293.49 g/mol |
| Exact Mass | 293.29 |
| IUPAC Name | ethane;3-(4-ethoxybutoxy)-N-propylpropanamide;molecular hydrogen |
| SMILES | CC.CC.CCCNC(=O)CCOCCCCOCC.[H][H] |
| InChI | InChI=1S/C12H25NO3.2C2H6.H2/c1-3-8-13-12(14)7-11-16-10-6-5-9-15-4-2;2*1-2;/h3-11H2,1-2H3,(H,13,14);2*1-2H3;1H |
| InChIKey | ZDMXGIGPPNINNL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.49 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|