C18H42N2O5 — CID 162749894
4-ethoxy-N-[3-[2-[2-[3-(ethylamino)propoxy]ethoxy]ethoxy]propyl]butanamide;molecular hydrogen (PubChem CID 162749894) has the molecular formula C18H42N2O5 and a molecular weight of 366.54 g/mol. Its IUPAC name is 4-ethoxy-N-[3-[2-[2-[3-(ethylamino)propoxy]ethoxy]ethoxy]propyl]butanamide;molecular hydrogen.
| Compound Name | 4-ethoxy-N-[3-[2-[2-[3-(ethylamino)propoxy]ethoxy]ethoxy]propyl]butanamide;molecular hydrogen |
|---|---|
| PubChem CID | 162749894 |
| Molecular Formula | C18H42N2O5 |
| Molecular Weight | 366.54 g/mol |
| Exact Mass | 366.31 |
| IUPAC Name | 4-ethoxy-N-[3-[2-[2-[3-(ethylamino)propoxy]ethoxy]ethoxy]propyl]butanamide;molecular hydrogen |
| SMILES | CCNCCCOCCOCCOCCCNC(=O)CCCOCC.[H][H].[H][H] |
| InChI | InChI=1S/C18H38N2O5.2H2/c1-3-19-9-6-12-23-14-16-25-17-15-24-13-7-10-20-18(21)8-5-11-22-4-2;;/h19H,3-17H2,1-2H3,(H,20,21);2*1H |
| InChIKey | AOBOVJBBTWBWLP-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.54 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|