C24H49N3O6 — CID 88902416
N'-[3-[2-[2-[3-(tert-butylamino)propoxy]ethoxy]ethoxy]propyl]-N-(3-ethoxypropyl)pentanediamide (PubChem CID 88902416) has the molecular formula C24H49N3O6 and a molecular weight of 475.67 g/mol. Its IUPAC name is N'-[3-[2-[2-[3-(tert-butylamino)propoxy]ethoxy]ethoxy]propyl]-N-(3-ethoxypropyl)pentanediamide.
| Compound Name | N'-[3-[2-[2-[3-(tert-butylamino)propoxy]ethoxy]ethoxy]propyl]-N-(3-ethoxypropyl)pentanediamide |
|---|---|
| PubChem CID | 88902416 |
| Molecular Formula | C24H49N3O6 |
| Molecular Weight | 475.67 g/mol |
| Exact Mass | 475.36 |
| IUPAC Name | N'-[3-[2-[2-[3-(tert-butylamino)propoxy]ethoxy]ethoxy]propyl]-N-(3-ethoxypropyl)pentanediamide |
| SMILES | CCOCCCNC(=O)CCCC(=O)NCCCOCCOCCOCCCNC(C)(C)C |
| InChI | InChI=1S/C24H49N3O6/c1-5-30-15-7-12-25-22(28)10-6-11-23(29)26-13-8-16-31-18-20-33-21-19-32-17-9-14-27-24(2,3)4/h27H,5-21H2,1-4H3,(H,25,28)(H,26,29) |
| InChIKey | JPULXAVUXADNJT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 107.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.67 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|