C22H46N2O5 — CID 166976016
3-[2-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethoxy]ethoxy]-N-(4,4-dimethylpentyl)propanamide (PubChem CID 166976016) has the molecular formula C22H46N2O5 and a molecular weight of 418.62 g/mol. Its IUPAC name is 3-[2-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethoxy]ethoxy]-N-(4,4-dimethylpentyl)propanamide.
| Compound Name | 3-[2-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethoxy]ethoxy]-N-(4,4-dimethylpentyl)propanamide |
|---|---|
| PubChem CID | 166976016 |
| Molecular Formula | C22H46N2O5 |
| Molecular Weight | 418.62 g/mol |
| Exact Mass | 418.34 |
| IUPAC Name | 3-[2-[2-[2-[2-(tert-butylamino)ethoxy]ethoxy]ethoxy]ethoxy]-N-(4,4-dimethylpentyl)propanamide |
| SMILES | CC(C)(C)CCCNC(=O)CCOCCOCCOCCOCCNC(C)(C)C |
| InChI | InChI=1S/C22H46N2O5/c1-21(2,3)9-7-10-23-20(25)8-12-26-14-16-28-18-19-29-17-15-27-13-11-24-22(4,5)6/h24H,7-19H2,1-6H3,(H,23,25) |
| InChIKey | DOIYRATUOLIPFY-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.62 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|