C21H43NO7S — CID 167584800
N-[2-[2-[2-[2-(4,4-dimethylpentoxy)ethoxy]ethoxy]ethoxy]ethyl]-3-propan-2-ylsulfonylpropanamide (PubChem CID 167584800) has the molecular formula C21H43NO7S and a molecular weight of 453.64 g/mol. Its IUPAC name is N-[2-[2-[2-[2-(4,4-dimethylpentoxy)ethoxy]ethoxy]ethoxy]ethyl]-3-propan-2-ylsulfonylpropanamide.
| Compound Name | N-[2-[2-[2-[2-(4,4-dimethylpentoxy)ethoxy]ethoxy]ethoxy]ethyl]-3-propan-2-ylsulfonylpropanamide |
|---|---|
| PubChem CID | 167584800 |
| Molecular Formula | C21H43NO7S |
| Molecular Weight | 453.64 g/mol |
| Exact Mass | 453.28 |
| IUPAC Name | N-[2-[2-[2-[2-(4,4-dimethylpentoxy)ethoxy]ethoxy]ethoxy]ethyl]-3-propan-2-ylsulfonylpropanamide |
| SMILES | CC(C)S(=O)(=O)CCC(=O)NCCOCCOCCOCCOCCCC(C)(C)C |
| InChI | InChI=1S/C21H43NO7S/c1-19(2)30(24,25)18-7-20(23)22-9-11-27-13-15-29-17-16-28-14-12-26-10-6-8-21(3,4)5/h19H,6-18H2,1-5H3,(H,22,23) |
| InChIKey | HQQOTNNTBNXEJD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 100.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.64 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|