C21H42N2O6S — CID 164702921
(2S)-2-[2-[3-(3,3-dimethylbutoxy)propanoylamino]ethylsulfonylamino]-7,7-dimethyloctanoic acid (PubChem CID 164702921) has the molecular formula C21H42N2O6S and a molecular weight of 450.64 g/mol. Its IUPAC name is (2S)-2-[2-[3-(3,3-dimethylbutoxy)propanoylamino]ethylsulfonylamino]-7,7-dimethyloctanoic acid.
| Compound Name | (2S)-2-[2-[3-(3,3-dimethylbutoxy)propanoylamino]ethylsulfonylamino]-7,7-dimethyloctanoic acid |
|---|---|
| PubChem CID | 164702921 |
| Molecular Formula | C21H42N2O6S |
| Molecular Weight | 450.64 g/mol |
| Exact Mass | 450.28 |
| IUPAC Name | (2S)-2-[2-[3-(3,3-dimethylbutoxy)propanoylamino]ethylsulfonylamino]-7,7-dimethyloctanoic acid |
| SMILES | CC(C)(C)CCCC[C@H](NS(=O)(=O)CCNC(=O)CCOCCC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C21H42N2O6S/c1-20(2,3)11-8-7-9-17(19(25)26)23-30(27,28)16-13-22-18(24)10-14-29-15-12-21(4,5)6/h17,23H,7-16H2,1-6H3,(H,22,24)(H,25,26)/t17-/m0/s1 |
| InChIKey | BNBJXKFCMANHJX-KRWDZBQOSA-N |
| XLogP | 2.92 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.64 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|