C12H25NO5S — CID 104936567
2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid (PubChem CID 104936567) has the molecular formula C12H25NO5S and a molecular weight of 295.40 g/mol. Its IUPAC name is 2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid.
| Compound Name | 2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid |
|---|---|
| PubChem CID | 104936567 |
| Molecular Formula | C12H25NO5S |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | 2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid |
| SMILES | COCCCC(NS(=O)(=O)CCC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C12H25NO5S/c1-12(2,3)7-9-19(16,17)13-10(11(14)15)6-5-8-18-4/h10,13H,5-9H2,1-4H3,(H,14,15) |
| InChIKey | WJCDSJUEUITQTA-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 92.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|