2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid

C12H25NO5S — CID 104936567

IUPAC2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid
SMILESCOCCCC(NS(=O)(=O)CCC(C)(C)C)C(=O)O
InChIInChI=1S/C12H25NO5S/c1-12(2,3)7-9-19(16,17)13-10(11(14)15)6-5-8-18-4/h10,13H,5-9H2,1-4H3,(H,14,15)
InChIKeyWJCDSJUEUITQTA-UHFFFAOYSA-N
MW295.40 g/mol
LogP1.22
Rot. Bonds9

About 2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid

2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid (PubChem CID 104936567) has the molecular formula C12H25NO5S and a molecular weight of 295.40 g/mol. Its IUPAC name is 2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid.

Molecular Properties

Compound Name2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid
PubChem CID104936567
Molecular FormulaC12H25NO5S
Molecular Weight295.40 g/mol
Exact Mass295.15
IUPAC Name2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid
SMILESCOCCCC(NS(=O)(=O)CCC(C)(C)C)C(=O)O
InChIInChI=1S/C12H25NO5S/c1-12(2,3)7-9-19(16,17)13-10(11(14)15)6-5-8-18-4/h10,13H,5-9H2,1-4H3,(H,14,15)
InChIKeyWJCDSJUEUITQTA-UHFFFAOYSA-N
XLogP1.22
TPSA92.70 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms19
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500295.40
LogP ≤ 51.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}

Analyze 2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid?
The IUPAC name of 2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid (CID 104936567) is 2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid.
What is the SMILES notation for 2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid?
The canonical SMILES for 2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid is COCCCC(NS(=O)(=O)CCC(C)(C)C)C(=O)O.
What is the InChIKey of 2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid?
The InChIKey is WJCDSJUEUITQTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H25NO5S/c1-12(2,3)7-9-19(16,17)13-10(11(14)15)6-5-8-18-4/h10,13H,5-9H2,1-4H3,(H,14,15).
What are the key properties of 2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid?
2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid has a molecular weight of 295.40 g/mol, XLogP of 1.22, 9 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,3-dimethylbutylsulfonylamino)-5-methoxypentanoic acid is sourced from PubChem (CID 104936567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).