C9H18N2O6S — CID 55172494
(2S)-5-amino-2-(3-methoxypropylsulfonylamino)-5-oxopentanoic acid (PubChem CID 55172494) has the molecular formula C9H18N2O6S and a molecular weight of 282.32 g/mol. Its IUPAC name is (2S)-5-amino-2-(3-methoxypropylsulfonylamino)-5-oxopentanoic acid.
| Compound Name | (2S)-5-amino-2-(3-methoxypropylsulfonylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 55172494 |
| Molecular Formula | C9H18N2O6S |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | (2S)-5-amino-2-(3-methoxypropylsulfonylamino)-5-oxopentanoic acid |
| SMILES | COCCCS(=O)(=O)N[C@@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H18N2O6S/c1-17-5-2-6-18(15,16)11-7(9(13)14)3-4-8(10)12/h7,11H,2-6H2,1H3,(H2,10,12)(H,13,14)/t7-/m0/s1 |
| InChIKey | GQPYWYPGRXAGAN-ZETCQYMHSA-N |
| XLogP | -1.34 |
| TPSA | 135.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|