C7H11N3O5S — CID 107830160
(2R)-5-amino-2-(cyanomethylsulfonylamino)-5-oxopentanoic acid (PubChem CID 107830160) has the molecular formula C7H11N3O5S and a molecular weight of 249.25 g/mol. Its IUPAC name is (2R)-5-amino-2-(cyanomethylsulfonylamino)-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-(cyanomethylsulfonylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107830160 |
| Molecular Formula | C7H11N3O5S |
| Molecular Weight | 249.25 g/mol |
| Exact Mass | 249.04 |
| IUPAC Name | (2R)-5-amino-2-(cyanomethylsulfonylamino)-5-oxopentanoic acid |
| SMILES | N#CCS(=O)(=O)N[C@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C7H11N3O5S/c8-3-4-16(14,15)10-5(7(12)13)1-2-6(9)11/h5,10H,1-2,4H2,(H2,9,11)(H,12,13)/t5-/m1/s1 |
| InChIKey | ZEHUGCLPJXKQLQ-RXMQYKEDSA-N |
| XLogP | -1.85 |
| TPSA | 150.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.25 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |