C9H15N3O5S — CID 107830169
(2R)-5-amino-2-(1-cyanopropylsulfonylamino)-5-oxopentanoic acid (PubChem CID 107830169) has the molecular formula C9H15N3O5S and a molecular weight of 277.30 g/mol. Its IUPAC name is (2R)-5-amino-2-(1-cyanopropylsulfonylamino)-5-oxopentanoic acid.
| Compound Name | (2R)-5-amino-2-(1-cyanopropylsulfonylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 107830169 |
| Molecular Formula | C9H15N3O5S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | (2R)-5-amino-2-(1-cyanopropylsulfonylamino)-5-oxopentanoic acid |
| SMILES | CCC(C#N)S(=O)(=O)N[C@H](CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H15N3O5S/c1-2-6(5-10)18(16,17)12-7(9(14)15)3-4-8(11)13/h6-7,12H,2-4H2,1H3,(H2,11,13)(H,14,15)/t6?,7-/m1/s1 |
| InChIKey | ZYFFWPPGUAPWQA-COBSHVIPSA-N |
| XLogP | -1.07 |
| TPSA | 150.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |