C9H14N2O6S — CID 114005099
(2R)-2-(1-cyanoethylsulfonylamino)-5-methoxy-5-oxopentanoic acid (PubChem CID 114005099) has the molecular formula C9H14N2O6S and a molecular weight of 278.29 g/mol. Its IUPAC name is (2R)-2-(1-cyanoethylsulfonylamino)-5-methoxy-5-oxopentanoic acid.
| Compound Name | (2R)-2-(1-cyanoethylsulfonylamino)-5-methoxy-5-oxopentanoic acid |
|---|---|
| PubChem CID | 114005099 |
| Molecular Formula | C9H14N2O6S |
| Molecular Weight | 278.29 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | (2R)-2-(1-cyanoethylsulfonylamino)-5-methoxy-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@@H](NS(=O)(=O)C(C)C#N)C(=O)O |
| InChI | InChI=1S/C9H14N2O6S/c1-6(5-10)18(15,16)11-7(9(13)14)3-4-8(12)17-2/h6-7,11H,3-4H2,1-2H3,(H,13,14)/t6?,7-/m1/s1 |
| InChIKey | UCSWKRCYGYDDPH-COBSHVIPSA-N |
| XLogP | -0.78 |
| TPSA | 133.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.29 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |