C8H14N2O8S — CID 114005093
(2S)-5-methoxy-2-(methoxycarbonylsulfamoylamino)-5-oxopentanoic acid (PubChem CID 114005093) has the molecular formula C8H14N2O8S and a molecular weight of 298.27 g/mol. Its IUPAC name is (2S)-5-methoxy-2-(methoxycarbonylsulfamoylamino)-5-oxopentanoic acid.
| Compound Name | (2S)-5-methoxy-2-(methoxycarbonylsulfamoylamino)-5-oxopentanoic acid |
|---|---|
| PubChem CID | 114005093 |
| Molecular Formula | C8H14N2O8S |
| Molecular Weight | 298.27 g/mol |
| Exact Mass | 298.05 |
| IUPAC Name | (2S)-5-methoxy-2-(methoxycarbonylsulfamoylamino)-5-oxopentanoic acid |
| SMILES | COC(=O)CC[C@H](NS(=O)(=O)NC(=O)OC)C(=O)O |
| InChI | InChI=1S/C8H14N2O8S/c1-17-6(11)4-3-5(7(12)13)9-19(15,16)10-8(14)18-2/h5,9H,3-4H2,1-2H3,(H,10,14)(H,12,13)/t5-/m0/s1 |
| InChIKey | XKPZALAFQWBETP-YFKPBYRVSA-N |
| XLogP | -1.42 |
| TPSA | 148.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.27 |
| LogP ≤ 5 | -1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |