C18H34N2O8S — CID 155093571
ditert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]pentanedioate (PubChem CID 155093571) has the molecular formula C18H34N2O8S and a molecular weight of 438.54 g/mol. Its IUPAC name is ditert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]pentanedioate.
| Compound Name | ditert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]pentanedioate |
|---|---|
| PubChem CID | 155093571 |
| Molecular Formula | C18H34N2O8S |
| Molecular Weight | 438.54 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | ditert-butyl 2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]pentanedioate |
| SMILES | CC(C)(C)OC(=O)CCC(NS(=O)(=O)NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H34N2O8S/c1-16(2,3)26-13(21)11-10-12(14(22)27-17(4,5)6)19-29(24,25)20-15(23)28-18(7,8)9/h12,19H,10-11H2,1-9H3,(H,20,23) |
| InChIKey | OHKAJBQYCFQEPH-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.54 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|