C11H23NO4S — CID 86641981
tert-butyl (2S)-2-(methanesulfonamido)-4-methylpentanoate (PubChem CID 86641981) has the molecular formula C11H23NO4S and a molecular weight of 265.38 g/mol. Its IUPAC name is tert-butyl (2S)-2-(methanesulfonamido)-4-methylpentanoate.
| Compound Name | tert-butyl (2S)-2-(methanesulfonamido)-4-methylpentanoate |
|---|---|
| PubChem CID | 86641981 |
| Molecular Formula | C11H23NO4S |
| Molecular Weight | 265.38 g/mol |
| Exact Mass | 265.13 |
| IUPAC Name | tert-butyl (2S)-2-(methanesulfonamido)-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NS(C)(=O)=O)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C11H23NO4S/c1-8(2)7-9(12-17(6,14)15)10(13)16-11(3,4)5/h8-9,12H,7H2,1-6H3/t9-/m0/s1 |
| InChIKey | IYDMZAPQQRTPBQ-VIFPVBQESA-N |
| XLogP | 1.29 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.38 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |