C16H25BrN2O4S — CID 90397184
tert-butyl (2S)-2-[(4-bromophenyl)sulfamoylamino]-4-methylpentanoate (PubChem CID 90397184) has the molecular formula C16H25BrN2O4S and a molecular weight of 421.36 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(4-bromophenyl)sulfamoylamino]-4-methylpentanoate.
| Compound Name | tert-butyl (2S)-2-[(4-bromophenyl)sulfamoylamino]-4-methylpentanoate |
|---|---|
| PubChem CID | 90397184 |
| Molecular Formula | C16H25BrN2O4S |
| Molecular Weight | 421.36 g/mol |
| Exact Mass | 420.07 |
| IUPAC Name | tert-butyl (2S)-2-[(4-bromophenyl)sulfamoylamino]-4-methylpentanoate |
| SMILES | CC(C)C[C@H](NS(=O)(=O)Nc1ccc(Br)cc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C16H25BrN2O4S/c1-11(2)10-14(15(20)23-16(3,4)5)19-24(21,22)18-13-8-6-12(17)7-9-13/h6-9,11,14,18-19H,10H2,1-5H3/t14-/m0/s1 |
| InChIKey | MTCPIYDGJKHFTR-AWEZNQCLSA-N |
| XLogP | 3.45 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.36 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |