C12H24N2O6S — CID 53315637
methyl (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]pentanoate (PubChem CID 53315637) has the molecular formula C12H24N2O6S and a molecular weight of 324.40 g/mol. Its IUPAC name is methyl (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]pentanoate.
| Compound Name | methyl (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]pentanoate |
|---|---|
| PubChem CID | 53315637 |
| Molecular Formula | C12H24N2O6S |
| Molecular Weight | 324.40 g/mol |
| Exact Mass | 324.14 |
| IUPAC Name | methyl (2S)-4-methyl-2-[(2-methylpropan-2-yl)oxycarbonylsulfamoylamino]pentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)NS(=O)(=O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H24N2O6S/c1-8(2)7-9(10(15)19-6)13-21(17,18)14-11(16)20-12(3,4)5/h8-9,13H,7H2,1-6H3,(H,14,16)/t9-/m0/s1 |
| InChIKey | ZNVMWKGFULTTIK-VIFPVBQESA-N |
| XLogP | 0.93 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.40 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |