C10H20N2O6S — CID 114465372
methyl 2-(ethoxycarbonylsulfamoylamino)-4-methylpentanoate (PubChem CID 114465372) has the molecular formula C10H20N2O6S and a molecular weight of 296.35 g/mol. Its IUPAC name is methyl 2-(ethoxycarbonylsulfamoylamino)-4-methylpentanoate.
| Compound Name | methyl 2-(ethoxycarbonylsulfamoylamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 114465372 |
| Molecular Formula | C10H20N2O6S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.10 |
| IUPAC Name | methyl 2-(ethoxycarbonylsulfamoylamino)-4-methylpentanoate |
| SMILES | CCOC(=O)NS(=O)(=O)NC(CC(C)C)C(=O)OC |
| InChI | InChI=1S/C10H20N2O6S/c1-5-18-10(14)12-19(15,16)11-8(6-7(2)3)9(13)17-4/h7-8,11H,5-6H2,1-4H3,(H,12,14) |
| InChIKey | XICIIDSMLWMUBH-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |