C9H19ClN2O4S — CID 107158297
ethyl N-[(2-chloro-4-methylpentyl)sulfamoyl]carbamate (PubChem CID 107158297) has the molecular formula C9H19ClN2O4S and a molecular weight of 286.78 g/mol. Its IUPAC name is ethyl N-[(2-chloro-4-methylpentyl)sulfamoyl]carbamate.
| Compound Name | ethyl N-[(2-chloro-4-methylpentyl)sulfamoyl]carbamate |
|---|---|
| PubChem CID | 107158297 |
| Molecular Formula | C9H19ClN2O4S |
| Molecular Weight | 286.78 g/mol |
| Exact Mass | 286.08 |
| IUPAC Name | ethyl N-[(2-chloro-4-methylpentyl)sulfamoyl]carbamate |
| SMILES | CCOC(=O)NS(=O)(=O)NCC(Cl)CC(C)C |
| InChI | InChI=1S/C9H19ClN2O4S/c1-4-16-9(13)12-17(14,15)11-6-8(10)5-7(2)3/h7-8,11H,4-6H2,1-3H3,(H,12,13) |
| InChIKey | QGCBUMIABCANGV-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.78 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|